Jump to:
loading...| Preferred Name |
(2,4,5-trichlorophenoxy)acetic acid |
|
| Synonyms |
|
|
| Definitions |
A chlorophenoxyacetic acid that has formula C8H5Cl3O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27903 |
|
| alternative term |
InChIKey=SMYMJHWAQXWPDB-UHFFFAOYSA-N 2,4,5-T (2,4,5-Trichlorphenoxy)essigsaeure Esteron 245 C8H5Cl3O3 OC(=O)COc1cc(Cl)c(Cl)cc1Cl InChI=1S/C8H5Cl3O3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h1-2H,3H2,(H,12,13) 2,4,5-Trichlorphenoxyessigsaeure (2,4,5-trichlorophenoxy)acetic acid 2,4,5-Trichlorophenoxyacetic acid Trioxone |
|
| definition |
A chlorophenoxyacetic acid that has formula C8H5Cl3O3. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_23582 |
|
| is conjugate acid of | ||
| label |
(2,4,5-trichlorophenoxy)acetic acid |
|
| prefixIRI |
CHEBI:27903 |
|
| prefLabel |
(2,4,5-trichlorophenoxy)acetic acid |
|
| subClassOf |
Create mapping