loading...| Preferred Name |
trimethobenzamide |
|
| Synonyms |
|
|
| Definitions |
The amide obtained by formal condensation of 3,4,5-trihydroxybenzoic acid with 4-[2-(N,N-dimethylamino)ethoxy]benzylamine. It is used to prevent nausea and vomitting in humans. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27796 |
|
| alternative term |
N-[[4-(2-dimethylaminoethoxy)phenyl]methyl]-3,4,5-trimethoxybenzamide trimethobenzamidum trimetobenzamida COc1cc(cc(OC)c1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 InChIKey=FEZBIKUBAYAZIU-UHFFFAOYSA-N trimethobenzamide C21H28N2O5 N-{4-[2-(dimethylamino)ethoxy]benzyl}-3,4,5-trimethoxybenzamide InChI=1S/C21H28N2O5/c1-23(2)10-11-28-17-8-6-15(7-9-17)14-22-21(24)16-12-18(25-3)20(27-5)19(13-16)26-4/h6-9,12-13H,10-11,14H2,1-5H3,(H,22,24) |
|
| definition |
The amide obtained by formal condensation of 3,4,5-trihydroxybenzoic acid with 4-[2-(N,N-dimethylamino)ethoxy]benzylamine. It is used to prevent nausea and vomitting in humans. |
|
| has role | ||
| label |
trimethobenzamide |
|
| prefixIRI |
CHEBI:27796 |
|
| prefLabel |
trimethobenzamide |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22702 |