Jump to:
loading...| Preferred Name |
acetophenone |
|
| Synonyms |
|
|
| Definitions |
The ketone resulting from the oxidation of 1-phenylethanol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27632 |
|
| alternative term |
InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 C8H8O Acetylbenzene 1-phenylethanone 1-Phenylethanone Methyl phenyl ketone CC(=O)c1ccccc1 benzoyl methide Phenyl methyl ketone InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone 1-phenylethan-1-one |
|
| definition |
The ketone resulting from the oxidation of 1-phenylethanol. |
|
| has role | ||
| label |
acetophenone |
|
| prefixIRI |
CHEBI:27632 |
|
| prefLabel |
acetophenone |
|
| subClassOf |
Create mapping