Jump to:
loading...| Preferred Name |
ambenonium |
|
| Synonyms |
|
|
| Definitions |
A symmetrical oxalamide-based bis-quaternary ammonium ion having ethyl and 2-chlorobenzyl groups attached to the nitrogens. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2627 |
|
| alternative term |
InChI=1S/C28H40Cl2N4O2/c1-5-33(6-2,21-23-13-9-11-15-25(23)29)19-17-31-27(35)28(36)32-18-20-34(7-3,8-4)22-24-14-10-12-16-26(24)30/h9-16H,5-8,17-22H2,1-4H3/p+2 CC[N+](CC)(CCNC(=O)C(=O)NCC[N+](CC)(CC)Cc1ccccc1Cl)Cc1ccccc1Cl InChIKey=OMHBPUNFVFNHJK-UHFFFAOYSA-P Ambenonium Base Ambenonium 2,2'-[(1,2-dioxoethane-1,2-diyl)diimino]bis[N-(2-chlorobenzyl)-N,N-diethylethanaminium] Ambenonum C28H42Cl2N4O2 |
|
| definition |
A symmetrical oxalamide-based bis-quaternary ammonium ion having ethyl and 2-chlorobenzyl groups attached to the nitrogens. |
|
| has role | ||
| label |
ambenonium |
|
| prefixIRI |
CHEBI:2627 |
|
| prefLabel |
ambenonium |
|
| subClassOf |
Create mapping