Preferred Name |
inosine |
|
Synonyms |
|
|
Definitions |
A member of the inosines that has formula C10H12N4O5. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17596 |
|
alternative term |
inosine INOSINE Inosin InChI=1S/C10H12N4O5/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18/h2-4,6-7,10,15-17H,1H2,(H,11,12,18)/t4-,6-,7-,10-/m1/s1 OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(O)ncnc12 InChIKey=UGQMRVRMYYASKQ-KQYNXXCUSA-N Inosine 9-beta-D-ribofuranosyl-9H-purin-6-ol inosinum 9-beta-D-ribofuranosylhypoxanthine hypoxanthosine hypoxanthine D-riboside C10H12N4O5 inosina |
|
definition |
A member of the inosines that has formula C10H12N4O5. |
|
label |
inosine |
|
prefixIRI |
CHEBI:17596 |
|
prefLabel |
inosine |
|
subClassOf |
Create mapping