Preferred Name |
homocystine |
|
Synonyms |
|
|
Definitions |
A member of the homocystines that has formula C8H16N2O4S2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17485 |
|
alternative term |
InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14) NC(CCSSCCC(N)C(O)=O)C(O)=O Homocystine InChIKey=ZTVZLYBCZNMWCF-UHFFFAOYSA-N 4,4'-dithiobis(2-aminobutyric acid) 4,4'-disulfanediylbis(2-aminobutanoic acid) C8H16N2O4S2 4,4'-Dithiobis(2-aminobutyric acid) |
|
definition |
A member of the homocystines that has formula C8H16N2O4S2. |
|
is tautomer of | ||
label |
homocystine |
|
prefixIRI |
CHEBI:17485 |
|
prefLabel |
homocystine |
|
subClassOf |
Create mapping