Jump to:
loading...| Preferred Name | quinoline | |
| Synonyms |
|
|
| Definitions |
The simplest member of the quinoline class of compounds, comprising a benzene ring ortho fused to C-2 and C-3 of a pyridine ring. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17362 |
|
| alternative term |
benzo[b]pyridine Quinoline InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H quinoline InChIKey=SMWDFEZZVXVKRB-UHFFFAOYSA-N Chinolin C9H7N c1ccc2ncccc2c1 |
|
| definition |
The simplest member of the quinoline class of compounds, comprising a benzene ring ortho fused to C-2 and C-3 of a pyridine ring. |
|
| label |
quinoline |
|
| prefixIRI |
CHEBI:17362 |
|
| prefLabel |
quinoline |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50893 http://purl.obolibrary.org/obo/CHEBI_26513 |
Create mapping