Jump to:
loading...| Preferred Name | L-isoleucine | |
| Synonyms |
|
|
| Definitions |
The L-enantiomer of isoleucine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17191 |
|
| alternative term |
InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 C6H13NO2 (2S,3S)-2-amino-3-methylpentanoic acid CC[C@H](C)[C@H](N)C(O)=O L-isoleucine I Ile alpha-amino-beta-methylvaleric acid ISOLEUCINE 2-Amino-3-methylvaleric acid L-Isoleucine |
|
| definition |
The L-enantiomer of isoleucine. |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-isoleucine |
|
| prefixIRI |
CHEBI:17191 |
|
| prefLabel |
L-isoleucine |
|
| subClassOf |
Create mapping