Jump to:
loading...| Preferred Name | L-threonine | |
| Synonyms |
|
|
| Definitions |
The L-enantiomer of the naturally-occurring amino acid threonine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16857 |
|
| alternative term |
(2S,3R)-2-amino-3-hydroxybutanoic acid (2S)-threonine InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1 C4H9NO3 L-alpha-amino-beta-hydroxybutyric acid THREONINE C[C@@H](O)[C@H](N)C(O)=O L-Threonin L-threonine InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N T Thr 2-Amino-3-hydroxybutyric acid L-Threonine |
|
| definition |
The L-enantiomer of the naturally-occurring amino acid threonine. |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| label |
L-threonine |
|
| prefixIRI |
CHEBI:16857 |
|
| prefLabel |
L-threonine |
|
| subClassOf |
Create mapping