Jump to:
loading...| Preferred Name | 4-hydroxybutyrate | |
| Synonyms |
|
|
| Definitions |
A C4, hydroxy fatty acid anion and the conjugate base of 4-hydroxybutyric acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16724 |
|
| alternative term |
4-hydroxybutanoate InChIKey=SJZRECIVHVDYJC-UHFFFAOYSA-M OCCCC([O-])=O gamma-hydroxybutyrate GHB C4H7O3 InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/p-1 |
|
| definition |
A C4, hydroxy fatty acid anion and the conjugate base of 4-hydroxybutyric acid. |
|
| has functional parent | ||
| is conjugate acid of | ||
| label |
4-hydroxybutyrate |
|
| prefixIRI |
CHEBI:16724 |
|
| prefLabel |
4-hydroxybutyrate |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_58951 |
Create mapping