loading...| Preferred Name |
lipoic acid |
|
| Synonyms |
|
|
| Definitions |
A heterocyclic thia fatty acid comprising pentanoic acid with a 1,2-dithiolan-3-yl group at the 5-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16494 |
|
| alternative term |
Acetate-replacing factor C8H14O2S2 OC(=O)CCCCC1CCSS1 6-thiotic acid Thioctansaeure 5-(1,2-dithiolan-3-yl)valeric acid 6-thioctic acid alpha-lipoic acid 5-(1,2-dithiolan-3-yl)pentanoic acid alpha-Liponsaeure 6,8-thioctic acid InChIKey=AGBQKNBQESQNJD-UHFFFAOYSA-N Biletan Thioctsaeure 1,2-dithiolane-3-pentanoic acid 6,8-thiotic acid Thioktsaeure 5-[3-(1,2-dithiolanyl)]pentanoic acid 5-(dithiolan-3-yl)valeric acid InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10) liponic acid 1,2-dithiolane-3-valeric acid |
|
| definition |
A heterocyclic thia fatty acid comprising pentanoic acid with a 1,2-dithiolan-3-yl group at the 5-position. |
|
| has functional parent | ||
| is conjugate acid of | ||
| label |
lipoic acid |
|
| prefixIRI |
CHEBI:16494 |
|
| prefLabel |
lipoic acid |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_39192 |