Jump to:
loading...| Preferred Name |
biopterin |
|
| Synonyms |
|
|
| Definitions |
A member of the biopterins that has formula C9H11N5O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15373 |
|
| alternative term |
InChIKey=LHQIJBMDNUYRAM-UHFFFAOYSA-N InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17) 2-amino-6-(1,2-dihydroxypropyl)pteridin-4(3H)-one C9H11N5O3 Biopterin 2-Amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone 2-amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone CC(O)C(O)c1cnc2nc(N)[nH]c(=O)c2n1 |
|
| definition |
A member of the biopterins that has formula C9H11N5O3. |
|
| has role | ||
| label |
biopterin |
|
| prefixIRI |
CHEBI:15373 |
|
| prefLabel |
biopterin |
|
| subClassOf |
Create mapping