Jump to:
loading...| Preferred Name | 5-aminolevulinate | |
| Synonyms |
|
|
| Definitions |
A monocarboxylic acid anion that has formula C5H8NO3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_12109 |
|
| alternative term |
InChI=1S/C5H9NO3/c6-3-4(7)1-2-5(8)9/h1-3,6H2,(H,8,9)/p-1 5-amino-4-oxopentanoate InChIKey=ZGXJTSGNIOSYLO-UHFFFAOYSA-M NCC(=O)CCC([O-])=O C5H8NO3 |
|
| definition |
A monocarboxylic acid anion that has formula C5H8NO3. |
|
| has functional parent | ||
| is conjugate base of | ||
| label |
5-aminolevulinate |
|
| prefixIRI |
CHEBI:12109 |
|
| prefLabel |
5-aminolevulinate |
|
| subClassOf |
Create mapping