Preferred Name |
thiopental |
|
Synonyms |
|
|
Definitions |
2-Thiobarbituric acid substituted at C-5 by ethyl and sec-pentyl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_102166 |
|
alternative term |
Thiopentone Thiopentobarbitone Penthiobarbital Thiopentobarbital InChIKey=IUJDSEJGGMCXSG-UHFFFAOYSA-N 2-Thio-5-ethyl-5-sec-pentylbarbituric acid (+-)-thiopental Pentothiobarbital C11H18N2O2S InChI=1S/C11H18N2O2S/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) 5-ethyl-5-(pentan-2-yl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione Thiopental 5-Ethyl-5-(1-methyl-butyl)-2-thioxo-dihydro-pyrimidine-4,6-dione CCCC(C)C1(CC)C(=O)NC(=S)NC1=O Thiopentobarbituric acid |
|
definition |
2-Thiobarbituric acid substituted at C-5 by ethyl and sec-pentyl groups. |
|
has functional parent | ||
has role | ||
is conjugate acid of | ||
label |
thiopental |
|
prefixIRI |
CHEBI:102166 |
|
prefLabel |
thiopental |
|
subClassOf |
Create mapping