Jump to:
loading...| Preferred Name | zidovudine | |
| Synonyms |
|
|
| Definitions |
A pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_10110 |
|
| alternative term |
Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O zidovudine InChI=1S/C10H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8/h3,6-8,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8+/m0/s1 Zidovudin InChIKey=HBOMLICNUCNMMY-XLPZGREQSA-N AZT Azidothymidine 3'-azido-3'-deoxythymidine Zidovudinum C10H13N5O4 |
|
| definition |
A pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_53756 |
|
| label |
zidovudine |
|
| prefixIRI |
CHEBI:10110 |
|
| prefLabel |
zidovudine |
|
| subClassOf |
Create mapping