Preferred Name |
thimerosal |
|
Synonyms |
sodium ethyl[2-(sulfanyl-kappaS)benzoato(2-)]mercurate(1-) sodium [(2-carboxylatophenyl)sulfanyl](ethyl)mercurate(1-) Thimerosal ethylmercurithiosalicylic acid sodium salt [(o-carboxyphenyl)thio]ethylmercury sodium salt sodium merthiolate ethylmercurithiosalicylate sodium mercurothiolate thiomersalate ethyl(2-mercaptobenzoato-S)mercury sodium salt thiomersalum sodium ethylmercurithiosalicylate Merthiolate o-(ethylmercurithio)benzoic acid sodium salt Thiomersal thiomersal tiomersal |
|
Definitions |
An alkylmercury compound (approximately 49% mercury by weight) used as an antiseptic and antifungal agent. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9546 |
|
charge |
0 |
|
database_cross_reference |
PMID:22658806 PMID:21616561 PMID:21785120 PMID:23145070 PMID:18837732 PMID:23843785 PMID:23992327 PMID:23223227 PMID:23949514 PMID:23282150 Reaxys:8169555 PMID:22015977 CAS:54-64-8 Gmelin:1677155 PMID:22811707 PMID:22366633 PMID:25042713 PMID:23554557 KEGG:D00864 Beilstein:8169555 PMID:23965928 PMID:23401210 PPDB:3062 VSDB:3062 |
|
definition |
An alkylmercury compound (approximately 49% mercury by weight) used as an antiseptic and antifungal agent. |
|
formula |
C9H9HgNaO2S C9H9HgO2S.Na |
|
has part | ||
has_exact_synonym |
sodium ethyl[2-(sulfanyl-kappaS)benzoato(2-)]mercurate(1-) sodium [(2-carboxylatophenyl)sulfanyl](ethyl)mercurate(1-) Thimerosal |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
ethylmercurithiosalicylic acid sodium salt [(o-carboxyphenyl)thio]ethylmercury sodium salt sodium merthiolate ethylmercurithiosalicylate sodium mercurothiolate thiomersalate ethyl(2-mercaptobenzoato-S)mercury sodium salt thiomersalum sodium ethylmercurithiosalicylate Merthiolate o-(ethylmercurithio)benzoic acid sodium salt Thiomersal thiomersal tiomersal |
|
id |
CHEBI:9546 |
|
in_subset | ||
inchi |
InChI=1S/C7H6O2S.C2H5.Hg.Na/c8-7(9)5-3-1-2-4-6(5)10;1-2;;/h1-4,10H,(H,8,9);1H2,2H3;;/q;;2*+1/p-2 |
|
inchikey |
RTKIYNMVFMVABJ-UHFFFAOYSA-L |
|
label |
thimerosal |
|
mass |
404.81233 |
|
monoisotopicmass |
405.99274 |
|
notation |
CHEBI:9546 |
|
prefLabel |
thimerosal |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_48218 http://purl.obolibrary.org/obo/CHEBI_86327 |
|
smiles |
[Na+].CC[Hg]Sc1ccccc1C([O-])=O |
|
subClassOf |