Preferred Name |
stanozolol |
|
Synonyms |
Androstanazole estanozolol stanozololum Strombaject Stromba Winstrol stanozolol (1S,3aS,3bR,5aS,10aS,10bS,12aS)-1,10a,12a-trimethyl-1,2,3,3a,3b,4,5,5a,6,7,10,10a,10b,11,12,12a-hexadecahydrocyclopenta[5,6]naphtho[1,2-f]indazol-1-ol |
|
Definitions |
An organic heteropentacyclic compound resulting from the formal condensation of the 3-keto-aldehyde moiety of oxymetholone with hydrazine. Like oxymetholone, it is a synthetic anabolic steroid. It has both anabolic and androgenic properties, and has been used to treat hereditary angioedema and various vascular disorders. It has also been widely abused by professional athletes. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9249 |
|
alternative term |
Androstanazole estanozolol stanozololum Strombaject Stromba Winstrol stanozolol (1S,3aS,3bR,5aS,10aS,10bS,12aS)-1,10a,12a-trimethyl-1,2,3,3a,3b,4,5,5a,6,7,10,10a,10b,11,12,12a-hexadecahydrocyclopenta[5,6]naphtho[1,2-f]indazol-1-ol |
|
charge |
0 |
|
database_cross_reference |
PMID:23873860 PMID:20020362 Drug_Central:2477 Reaxys:8359772 PMID:24405322 HMDB:HMDB0003116 PMID:21496393 PMID:22197661 KEGG:D00444 PMID:23374366 PMID:22729959 Wikipedia:Stanozolol PMID:20209649 PMID:23978309 Patent:US3030358 DrugBank:DB06718 PMID:20480277 KEGG:C07311 CAS:10418-03-8 PMID:24021270 PMID:21769864 |
|
definition |
An organic heteropentacyclic compound resulting from the formal condensation of the 3-keto-aldehyde moiety of oxymetholone with hydrazine. Like oxymetholone, it is a synthetic anabolic steroid. It has both anabolic and androgenic properties, and has been used to treat hereditary angioedema and various vascular disorders. It has also been widely abused by professional athletes. |
|
formula |
C21H32N2O |
|
has_exact_synonym |
(1S,3aS,3bR,5aS,10aS,10bS,12aS)-1,10a,12a-trimethyl-1,2,3,3a,3b,4,5,5a,6,7,10,10a,10b,11,12,12a-hexadecahydrocyclopenta[5,6]naphtho[1,2-f]indazol-1-ol |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Androstanazole estanozolol stanozololum Strombaject Stromba Winstrol stanozolol |
|
id |
CHEBI:9249 |
|
in_subset | ||
inchi |
InChI=1S/C21H32N2O/c1-19-11-13-12-22-23-18(13)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)24/h12,14-17,24H,4-11H2,1-3H3,(H,22,23)/t14-,15+,16-,17-,19-,20-,21-/m0/s1 |
|
inchikey |
LKAJKIOFIWVMDJ-IYRCEVNGSA-N |
|
label |
stanozolol |
|
mass |
328.49160 |
|
monoisotopicmass |
328.25146 |
|
notation |
CHEBI:9249 |
|
prefLabel |
stanozolol |
|
smiles |
C[C@]1(O)CC[C@H]2[C@@H]3CC[C@H]4Cc5[nH]ncc5C[C@]4(C)[C@H]3CC[C@]12C |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38164 http://purl.obolibrary.org/obo/CHEBI_35343 |