loading...| Preferred Name |
salsalate |
|
| Synonyms |
2-[(2-hydroxybenzoyl)oxy]benzoic acid Salicyloxysalicylic acid O-Salicylcylsalicylsaeure Salicyloylsalicylic acid o-Salicylsalicylic acid Salicylic acid bimolecular ester 2-Carboxyphenyl salicylate Disalicylic acid Disalicylsaeure salicylsalicylic acid Sasapyrinum Disalcid Sasapyrin Sasapyrine salsalate salsalato salsalatum |
|
| Definitions |
A dimeric benzoate ester obtained by intermolecular condensation between the carboxy of one molecule of salicylic acid with the phenol group of a second. It is a prodrug for salycylic acid that is used for treatment of rheumatoid arthritis and osteoarthritis and also shows activity against type II diabetes. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9014 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21289240 PMID:20613460 PMID:24130358 CAS:552-94-3 PMID:22782506 PMID:21938543 DrugBank:DB01399 PMID:23948064 KEGG:D00428 PMID:21519323 Drug_Central:2420 PMID:22357964 PMID:23680037 Reaxys:2590908 PMID:22784842 PMID:21903749 Wikipedia:Salsalate PMID:22517326 PMID:20876710 PMID:23370525 PMID:23801715 PMID:23817718 PMID:21764223 PMID:23817699 PMID:23825542 PMID:28166217 PMID:22388922 PMID:21617098 PMID:23871515 PMID:19747808 |
|
| definition |
A dimeric benzoate ester obtained by intermolecular condensation between the carboxy of one molecule of salicylic acid with the phenol group of a second. It is a prodrug for salycylic acid that is used for treatment of rheumatoid arthritis and osteoarthritis and also shows activity against type II diabetes. |
|
| formula |
C14H10O5 |
|
| has_exact_synonym |
2-[(2-hydroxybenzoyl)oxy]benzoic acid |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Salicyloxysalicylic acid O-Salicylcylsalicylsaeure Salicyloylsalicylic acid o-Salicylsalicylic acid Salicylic acid bimolecular ester 2-Carboxyphenyl salicylate Disalicylic acid Disalicylsaeure salicylsalicylic acid Sasapyrinum Disalcid Sasapyrin Sasapyrine salsalate salsalato salsalatum |
|
| id |
CHEBI:9014 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H10O5/c15-11-7-3-1-5-9(11)14(18)19-12-8-4-2-6-10(12)13(16)17/h1-8,15H,(H,16,17) |
|
| inchikey |
WVYADZUPLLSGPU-UHFFFAOYSA-N |
|
| label |
salsalate |
|
| mass |
258.22620 |
|
| monoisotopicmass |
258.05282 |
|
| notation |
CHEBI:9014 |
|
| prefLabel |
salsalate |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_35526 http://purl.obolibrary.org/obo/CHEBI_35625 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
| smiles |
OC(=O)c1ccccc1OC(=O)c1ccccc1O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26596 http://purl.obolibrary.org/obo/CHEBI_22723 |