loading...| Preferred Name | (-)-epicatechin | |
| Synonyms |
(2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (-)-Epicatechin |
|
| Definitions |
A catechin with (2R,3R)-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_90 |
|
| alternative term |
(2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (-)-Epicatechin |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
Reaxys:92760 LIPID_MAPS_instance:LMPK12020003 KNApSAcK:C00000956 KEGG:C09727 CAS:490-46-0 LINCS:LSM-20956 MetaCyc:CPD-7630 PMID:7655336 PMID:10427682 |
|
| definition |
A catechin with (2R,3R)-configuration. |
|
| formula |
C15H14O6 |
|
| has_alternative_id |
CHEBI:18484 |
|
| has_exact_synonym |
(2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (-)-Epicatechin |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:90 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15-/m1/s1 |
|
| inchikey |
PFTAWBLQPZVEMU-UKRRQHHQSA-N |
|
| is_enantiomer_of | ||
| label |
(-)-epicatechin |
|
| mass |
290.26810 |
|
| monoisotopicmass |
290.07904 |
|
| notation |
CHEBI:90 |
|
| prefLabel |
(-)-epicatechin |
|
| RO_0000087 | ||
| smiles |
[H][C@@]1(Oc2cc(O)cc(O)c2C[C@H]1O)c1ccc(O)c(O)c1 |
|
| subClassOf |