loading...| Preferred Name |
eslicarbazepine acetate |
|
| Synonyms |
(10S)-5-carbamoyl-10,11-dihydro-5H-dibenzo[b,f]azepin-10-yl acetate (10S)-10-acetoxy-10,11-dihydro-5H-dibenz[b,f]azepine-5-carboxamide |
|
| Definitions |
The acetate ester, with S configuration, of licarbazepine. An anticonvulsant, it is approved for use in Europe and the United States as an adjunctive therapy for epilepsy. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_87016 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24972948 PMID:22322005 PMID:25528898 Drug_Central:4303 PMID:26136845 PMID:24908564 CAS:236395-14-5 |
|
| definition |
The acetate ester, with S configuration, of licarbazepine. An anticonvulsant, it is approved for use in Europe and the United States as an adjunctive therapy for epilepsy. |
|
| formula |
C17H16N2O3 |
|
| has_exact_synonym |
(10S)-5-carbamoyl-10,11-dihydro-5H-dibenzo[b,f]azepin-10-yl acetate |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(10S)-10-acetoxy-10,11-dihydro-5H-dibenz[b,f]azepine-5-carboxamide |
|
| id |
CHEBI:87016 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H16N2O3/c1-11(20)22-16-10-12-6-2-4-8-14(12)19(17(18)21)15-9-5-3-7-13(15)16/h2-9,16H,10H2,1H3,(H2,18,21)/t16-/m0/s1 |
|
| inchikey |
QIALRBLEEWJACW-INIZCTEOSA-N |
|
| label |
eslicarbazepine acetate |
|
| mass |
296.32050 |
|
| monoisotopicmass |
296.11609 |
|
| notation |
CHEBI:87016 |
|
| prefLabel |
eslicarbazepine acetate |
|
| RO_0000087 | ||
| smiles |
CC(=O)O[C@H]1Cc2ccccc2N(C(N)=O)c2ccccc12 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_47622 http://purl.obolibrary.org/obo/CHEBI_47857 |