loading...| Preferred Name | pyrantel | |
| Synonyms |
pirantel pyrantel pyrantelum 1-methyl-2-[(E)-2-(2-thienyl)vinyl]-1,4,5,6-tetrahydropyrimidine |
|
| Definitions |
A carboxamidine that is 1,4,5,6-tetrahydropyrimidine that is substituted at position 1 by a methyl group and at position 2 by an (E)-2-(2-thienyl)vinyl group. It is used, particularly as the embonate [4,4'-methylenebis(3-hydroxy-2-naphthoate)] salt, as an anthelmintic that is effective against intestinal nematodes including threadworms, roundworms and hookworms, and is included in the WHO 'Model List of Essential Medicines'. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8654 |
|
| alternative term |
pirantel pyrantel pyrantelum 1-methyl-2-[(E)-2-(2-thienyl)vinyl]-1,4,5,6-tetrahydropyrimidine |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
Patent:BE658987 PMID:21689886 PMID:5124439 Drug_Central:2999 KEGG:D08451 KEGG:C07409 Wikipedia:Pyrantel PMID:552733 Patent:US3502661 PMID:2619378 PMID:7402460 CAS:15686-83-6 PMID:20307935 Reaxys:518505 |
|
| definition |
A carboxamidine that is 1,4,5,6-tetrahydropyrimidine that is substituted at position 1 by a methyl group and at position 2 by an (E)-2-(2-thienyl)vinyl group. It is used, particularly as the embonate [4,4'-methylenebis(3-hydroxy-2-naphthoate)] salt, as an anthelmintic that is effective against intestinal nematodes including threadworms, roundworms and hookworms, and is included in the WHO 'Model List of Essential Medicines'. |
|
| formula |
C11H14N2S |
|
| has_exact_synonym |
1-methyl-2-[(E)-2-(2-thienyl)vinyl]-1,4,5,6-tetrahydropyrimidine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pirantel pyrantel pyrantelum |
|
| id |
CHEBI:8654 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H14N2S/c1-13-8-3-7-12-11(13)6-5-10-4-2-9-14-10/h2,4-6,9H,3,7-8H2,1H3/b6-5+ |
|
| inchikey |
YSAUAVHXTIETRK-AATRIKPKSA-N |
|
| label |
pyrantel |
|
| mass |
206.30700 |
|
| monoisotopicmass |
206.08777 |
|
| notation |
CHEBI:8654 |
|
| prefLabel |
pyrantel |
|
| RO_0000087 | ||
| smiles |
CN1CCCN=C1\C=C\c1cccs1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_78715 |