loading...| Preferred Name |
neutral red |
|
| Synonyms |
N(8),N(8),3-trimethylphenazine-2,8-diamine hydrochloride Toluylene Red 3-Amino-7-dimethylamino-2-methylphenazine hydrochloride C.I. Basic Red 5, monohydrochloride C.I. Basic Red 5 Neutral Red chloride |
|
| Definitions |
A hydrochloride obtained by combining the free base of neutral red with one equivalent of hydrochloric acid. Neutral red acts as a pH indicator, changing from red to yellow between pH 6.8 and 8.0. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_86370 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:3918740 PMID:26094419 PMID:26065811 PMID:25107459 PMID:26094195 Wikipedia:Neutral_red CAS:553-24-2 PMID:26096579 |
|
| definition |
A hydrochloride obtained by combining the free base of neutral red with one equivalent of hydrochloric acid. Neutral red acts as a pH indicator, changing from red to yellow between pH 6.8 and 8.0. |
|
| formula |
C15H17ClN4 |
|
| has part | ||
| has_exact_synonym |
N(8),N(8),3-trimethylphenazine-2,8-diamine hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Toluylene Red 3-Amino-7-dimethylamino-2-methylphenazine hydrochloride C.I. Basic Red 5, monohydrochloride C.I. Basic Red 5 Neutral Red chloride |
|
| id |
CHEBI:86370 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H16N4.ClH/c1-9-6-13-15(8-11(9)16)18-14-7-10(19(2)3)4-5-12(14)17-13;/h4-8H,16H2,1-3H3;1H |
|
| inchikey |
PGSADBUBUOPOJS-UHFFFAOYSA-N |
|
| label |
neutral red |
|
| mass |
288.77500 |
|
| monoisotopicmass |
288.11417 |
|
| notation |
CHEBI:86370 |
|
| prefLabel |
neutral red |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50412 |
|
| smiles |
Cl.CN(C)c1ccc2nc3cc(C)c(N)cc3nc2c1 |
|
| subClassOf |