Jump to:
loading...| Preferred Name |
ferrous carbonate |
|
| Synonyms |
iron(II) carbonate Iron carbonate Ferrous monocarbonate Iron II carbonate iron(2+) carbonate siderite |
|
| Definitions |
A carbonate salt in which the counter-ion is iron in the +2 oxidation state. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_86235 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:13192773 Wikipedia:Siderite CAS:563-71-3 PMID:22865064 Reaxys:16513103 PMID:25406864 PMID:25898127 PMID:24790539 |
|
| definition |
A carbonate salt in which the counter-ion is iron in the +2 oxidation state. |
|
| formula |
CFeO3 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
iron(II) carbonate Iron carbonate Ferrous monocarbonate Iron II carbonate iron(2+) carbonate siderite |
|
| id |
CHEBI:86235 |
|
| in_subset | ||
| inchi |
InChI=1S/CH2O3.Fe/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
|
| inchikey |
RAQDACVRFCEPDA-UHFFFAOYSA-L |
|
| label |
ferrous carbonate |
|
| mass |
115.85400 |
|
| monoisotopicmass |
115.91968 |
|
| notation |
CHEBI:86235 |
|
| prefLabel |
ferrous carbonate |
|
| smiles |
[Fe++].[O-]C([O-])=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_64708 |
Create mapping