Preferred Name |
avibactam |
|
Synonyms |
(2S,5R)-7-oxo-6-(sulfooxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxamide NXL 104 NXL104 |
|
Definitions |
A member of the class of azabicycloalkanes that is (2S,5R)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide in which the amino hydrogen at position 6 is replaced by a sulfooxy group. Used (in the form of its sodium salt) in combination with ceftazidime pentahydrate for the treatment of complicated urinary tract infections including pyelonephritis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_85984 |
|
charge |
0 |
|
database_cross_reference |
CAS:1192500-31-4 PMID:25845861 PMID:25845862 PMID:25487794 PMID:25748553 PMID:25361682 Wikipedia:Avibactam PMID:25979639 PMID:25583732 PMID:25737290 PMID:25406838 Drug_Central:4946 PMID:25534728 PMID:25813217 PMID:25444674 PMID:25753646 Reaxys:22542284 PMID:25963984 PMID:25666153 PMID:26024868 PMID:25691639 PMID:25645843 PMID:25987638 PMID:25957381 |
|
definition |
A member of the class of azabicycloalkanes that is (2S,5R)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide in which the amino hydrogen at position 6 is replaced by a sulfooxy group. Used (in the form of its sodium salt) in combination with ceftazidime pentahydrate for the treatment of complicated urinary tract infections including pyelonephritis. |
|
formula |
C7H11N3O6S |
|
has_exact_synonym |
(2S,5R)-7-oxo-6-(sulfooxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
NXL 104 NXL104 |
|
id |
CHEBI:85984 |
|
in_subset | ||
inchi |
InChI=1S/C7H11N3O6S/c8-6(11)5-2-1-4-3-9(5)7(12)10(4)16-17(13,14)15/h4-5H,1-3H2,(H2,8,11)(H,13,14,15)/t4-,5+/m1/s1 |
|
inchikey |
NDCUAPJVLWFHHB-UHNVWZDZSA-N |
|
is_conjugate_acid_of | ||
label |
avibactam |
|
mass |
265.24400 |
|
monoisotopicmass |
265.03686 |
|
notation |
CHEBI:85984 |
|
prefLabel |
avibactam |
|
RO_0000087 | ||
smiles |
NC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(O)(=O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_47857 http://purl.obolibrary.org/obo/CHEBI_38295 |