loading...| Preferred Name | pravastatin sodium | |
| Synonyms |
sodium (3R,5R)-3,5-dihydroxy-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoate |
|
| Definitions |
An organic sodium salt that is the sodium salt of pravastatin. A reversible inhibitor of 3-hydroxy-3-methylglutaryl-coenzyme A (HMG-CoA), it is used for lowering cholesterol and preventing cardiovascular disease. It is one of the lower potency statins, but has the advantage of fewer side effects compared with lovastatin and simvastatin. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8361 |
|
| alternative term |
sodium (3R,5R)-3,5-dihydroxy-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoate |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00893 HMDB:HMDB0005022 Wikipedia:Parvaststin Reaxys:4224939 PMID:1926908 CAS:81131-70-6 DrugBank:DB00175 PMID:1680649 PMID:1425808 |
|
| definition |
An organic sodium salt that is the sodium salt of pravastatin. A reversible inhibitor of 3-hydroxy-3-methylglutaryl-coenzyme A (HMG-CoA), it is used for lowering cholesterol and preventing cardiovascular disease. It is one of the lower potency statins, but has the advantage of fewer side effects compared with lovastatin and simvastatin. |
|
| formula |
C23H35NaO7 |
|
| has part | ||
| has_exact_synonym |
sodium (3R,5R)-3,5-dihydroxy-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:8361 |
|
| in_subset | ||
| inchi |
InChI=1S/C23H36O7.Na/c1-4-13(2)23(29)30-20-11-17(25)9-15-6-5-14(3)19(22(15)20)8-7-16(24)10-18(26)12-21(27)28;/h5-6,9,13-14,16-20,22,24-26H,4,7-8,10-12H2,1-3H3,(H,27,28);/q;+1/p-1/t13-,14-,16+,17+,18+,19-,20-,22-;/m0./s1 |
|
| inchikey |
VWBQYTRBTXKKOG-IYNICTALSA-M |
|
| label |
pravastatin sodium |
|
| mass |
446.50960 |
|
| monoisotopicmass |
446.22805 |
|
| notation |
CHEBI:8361 |
|
| overlaps | ||
| prefLabel |
pravastatin sodium |
|
| smiles |
[Na+].[H][C@]12[C@H](C[C@H](O)C=C1C=C[C@H](C)[C@@H]2CC[C@@H](O)C[C@@H](O)CC([O-])=O)OC(=O)[C@@H](C)CC |
|
| subClassOf |