Preferred Name |
pramipexole |
|
Synonyms |
(6S)-N(6)-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine pramipexolum 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-N(sup 6)-propyl-, (S)- pramipexole (-)-Pramipexole pramipexol |
|
Definitions |
A member of the class of benzothiazoles that is 4,5,6,7-tetrahydro-1,3-benzothiazole in which the hydrogens at the 2 and 6-pro-S-positions are substituted by amino and propylamino groups, respectively. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8356 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D05575 LINCS:LSM-5243 KEGG:D00559 Beilstein:6479326 Patent:US4886812 Drug_Central:2233 Wikipedia:Pramipexole Patent:EP186087 DrugBank:DB00413 CAS:104632-26-0 |
|
definition |
A member of the class of benzothiazoles that is 4,5,6,7-tetrahydro-1,3-benzothiazole in which the hydrogens at the 2 and 6-pro-S-positions are substituted by amino and propylamino groups, respectively. |
|
formula |
C10H17N3S |
|
has_exact_synonym |
(6S)-N(6)-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
pramipexolum 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-N(sup 6)-propyl-, (S)- pramipexole (-)-Pramipexole pramipexol |
|
id |
CHEBI:8356 |
|
in_subset | ||
inchi |
InChI=1S/C10H17N3S/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8/h7,12H,2-6H2,1H3,(H2,11,13)/t7-/m0/s1 |
|
inchikey |
FASDKYOPVNHBLU-ZETCQYMHSA-N |
|
is_conjugate_base_of | ||
label |
pramipexole |
|
mass |
211.32820 |
|
monoisotopicmass |
211.11432 |
|
notation |
CHEBI:8356 |
|
prefLabel |
pramipexole |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_51065 |
|
smiles |
CCCN[C@H]1CCc2nc(N)sc2C1 |
|
subClassOf |