Preferred Name |
glycodeoxycholate |
|
Synonyms |
glycodeoxycholate {[(3alpha,5beta,12alpha)-3,12-dihydroxy-24-oxocholan-24-yl]amino}acetate |
|
Definitions |
A N-acylglycinate that is the conjugate base of glycodeoxycholic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_82982 |
|
charge |
-1 |
|
definition |
A N-acylglycinate that is the conjugate base of glycodeoxycholic acid. |
|
formula |
C26H42NO5 |
|
has_exact_synonym |
glycodeoxycholate {[(3alpha,5beta,12alpha)-3,12-dihydroxy-24-oxocholan-24-yl]amino}acetate |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:82982 |
|
in_subset | ||
inchi |
InChI=1S/C26H43NO5/c1-15(4-9-23(30)27-14-24(31)32)19-7-8-20-18-6-5-16-12-17(28)10-11-25(16,2)21(18)13-22(29)26(19,20)3/h15-22,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/p-1/t15-,16-,17-,18+,19-,20+,21+,22+,25+,26-/m1/s1 |
|
inchikey |
WVULKSPCQVQLCU-BUXLTGKBSA-M |
|
is_conjugate_base_of | ||
label |
glycodeoxycholate |
|
mass |
448.616 |
|
monoisotopicmass |
448.30685 |
|
notation |
CHEBI:82982 |
|
prefLabel |
glycodeoxycholate |
|
RO_0000087 | ||
smiles |
C1[C@@]2([C@]3(C[C@@H]([C@]4([C@]([C@@]3(CC[C@@]2(C[C@@H](C1)O)[H])[H])(CC[C@@]4([C@@H](CCC(NCC([O-])=O)=O)C)[H])[H])C)O)[H])C |
|
subClassOf |