Preferred Name |
phenyl acetate |
|
Synonyms |
Phenyl acetate phenyl acetate Phenol acetate Acetic acid,phenyl ester Acetylphenol |
|
Definitions |
An acetate ester obtained by the formal condensation of phenol with acetic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8082 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Phenyl_acetate CAS:122-79-2 Beilstein:636458 Reaxys:636458 KEGG:C00548 PMID:11121229 KEGG:C15583 |
|
definition |
An acetate ester obtained by the formal condensation of phenol with acetic acid. |
|
formula |
C8H8O2 |
|
has_exact_synonym |
Phenyl acetate phenyl acetate |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Phenol acetate Acetic acid,phenyl ester Acetylphenol |
|
id |
CHEBI:8082 |
|
in_subset | ||
inchi |
InChI=1S/C8H8O2/c1-7(9)10-8-5-3-2-4-6-8/h2-6H,1H3 |
|
inchikey |
IPBVNPXQWQGGJP-UHFFFAOYSA-N |
|
label |
phenyl acetate |
|
mass |
136.14792 |
|
monoisotopicmass |
136.05243 |
|
notation |
CHEBI:8082 |
|
prefLabel |
phenyl acetate |
|
smiles |
CC(=O)Oc1ccccc1 |
|
subClassOf |
Create mapping