Preferred Name |
phentolamine |
|
Synonyms |
3-[(4,5-dihydro-1H-imidazol-2-ylmethyl)(4-methylphenyl)amino]phenol fentolamina 2-(N-(m-hydroxyphenyl)-p-toluidinomethyl)imidazoline phentolaminum Phentolamine mesylate phentolamine Regitina Regitine Rogitine |
|
Definitions |
A substituted aniline that is 3-aminophenol in which the hydrogens of the amino group are replaced by 4-methylphenyl and 4,5-dihydro-1H-imidazol-2-ylmethyl groups respectively. An alpha-adrenergic antagonist, it is used for the treatment of hypertension. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8081 |
|
charge |
0 |
|
database_cross_reference |
Patent:US2503059 LINCS:LSM-4022 PMID:23658874 PMID:23926134 Drug_Central:2142 KEGG:D00509 PMID:23522530 HMDB:HMDB0014830 CAS:50-60-2 PMID:23666670 Wikipedia:Phentolamine Reaxys:272944 PMID:23438114 PMID:23887290 KEGG:D08362 DrugBank:DB00692 |
|
definition |
A substituted aniline that is 3-aminophenol in which the hydrogens of the amino group are replaced by 4-methylphenyl and 4,5-dihydro-1H-imidazol-2-ylmethyl groups respectively. An alpha-adrenergic antagonist, it is used for the treatment of hypertension. |
|
formula |
C17H19N3O |
|
has_exact_synonym |
3-[(4,5-dihydro-1H-imidazol-2-ylmethyl)(4-methylphenyl)amino]phenol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
fentolamina 2-(N-(m-hydroxyphenyl)-p-toluidinomethyl)imidazoline phentolaminum Phentolamine mesylate phentolamine Regitina Regitine Rogitine |
|
id |
CHEBI:8081 |
|
in_subset | ||
inchi |
InChI=1S/C17H19N3O/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15/h2-8,11,21H,9-10,12H2,1H3,(H,18,19) |
|
inchikey |
MRBDMNSDAVCSSF-UHFFFAOYSA-N |
|
label |
phentolamine |
|
mass |
281.35230 |
|
monoisotopicmass |
281.15281 |
|
notation |
CHEBI:8081 |
|
prefLabel |
phentolamine |
|
RO_0000087 | ||
smiles |
Cc1ccc(cc1)N(CC1=NCCN1)c1cccc(O)c1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24780 http://purl.obolibrary.org/obo/CHEBI_33853 |