loading...| Preferred Name | phenmetrazine | |
| Synonyms |
2-Phenyl-3-Methylmorpholine 3-methyl-2-phenylmorpholine |
|
| Definitions |
A member of the class of morpholines that is morpholine substituted with a phenyl group at position 2 and a methyl group at position 3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8067 |
|
| alternative term |
2-Phenyl-3-Methylmorpholine 3-methyl-2-phenylmorpholine |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2133 PMID:4125018 HMDB:HMDB0014968 Reaxys:140490 PMID:14196928 PMID:5356063 KEGG:C07432 Wikipedia:Phenmetrazine PMID:23211394 DrugBank:DB00830 CAS:134-49-6 |
|
| definition |
A member of the class of morpholines that is morpholine substituted with a phenyl group at position 2 and a methyl group at position 3. |
|
| formula |
C11H15NO |
|
| has_exact_synonym |
3-methyl-2-phenylmorpholine |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Phenyl-3-Methylmorpholine |
|
| id |
CHEBI:8067 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H15NO/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3 |
|
| inchikey |
OOBHFESNSZDWIU-UHFFFAOYSA-N |
|
| label |
phenmetrazine |
|
| mass |
177.24290 |
|
| monoisotopicmass |
177.11536 |
|
| notation |
CHEBI:8067 |
|
| prefLabel |
phenmetrazine |
|
| RO_0000087 | ||
| smiles |
CC1NCCOC1c1ccccc1 |
|
| subClassOf |