Preferred Name |
phenacetin |
|
Synonyms |
N-(4-ethoxyphenyl)acetamide Phenacetin Acetphenetidin Commotional Acetophenetin 1-Acetamido-4-ethoxybenzene Contradouleur Phenacetine Acetophenetidin 4-Ethoxyacetanilide Acetophenetidine Phenacetinum Achrocidin Codempiral Contradol Fenacetina phenacetin |
|
Definitions |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a 4-ethoxyphenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8050 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Phenacetin Reaxys:1869238 KEGG:C07591 PMID:24201458 PMID:24447449 LINCS:LSM-2851 DrugBank:DB03783 KEGG:D00569 Patent:US2887513 CAS:62-44-2 PDBeChem:N4E Drug_Central:2115 |
|
definition |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a 4-ethoxyphenyl group. |
|
formula |
C10H13NO2 |
|
has_exact_synonym |
N-(4-ethoxyphenyl)acetamide Phenacetin |
|
has_functional_parent |
http://purl.obolibrary.org/obo/CHEBI_28884 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Acetphenetidin Commotional Acetophenetin 1-Acetamido-4-ethoxybenzene N-(4-ethoxyphenyl)acetamide Contradouleur Phenacetine Acetophenetidin 4-Ethoxyacetanilide Acetophenetidine Phenacetinum Achrocidin Codempiral Contradol Fenacetina phenacetin |
|
id |
CHEBI:8050 |
|
in_subset | ||
inchi |
InChI=1S/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12) |
|
inchikey |
CPJSUEIXXCENMM-UHFFFAOYSA-N |
|
label |
phenacetin |
|
mass |
179.216 |
|
monoisotopicmass |
179.09463 |
|
notation |
CHEBI:8050 |
|
prefLabel |
phenacetin |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_49110 |
|
smiles |
C=1C=C(OCC)C=CC1NC(C)=O |
|
subClassOf |