loading...| Preferred Name |
pergolide mesylate |
|
| Synonyms |
(8beta)-8-[(methylsulfanyl)methyl]-6-propylergoline methanesulfonate pergolide methanesulfonate Pergolide mesilate (8beta)-8-[(methylsulfanyl)methyl]-6-propylergolin-6-ium methanesulfonate pergolide monomethanesulfonate pergolide monomesylate Permax |
|
| Definitions |
A methanesulfonate salt obtained from pergolide by mixing eqimolar amount of pergolide and methanesulfonic acid. A dopamine D2 receptor agonist which also has D1 and D2 agonist properties, it is used in the management of Parkinson's disease, although it was withdrawn from the U.S. and Canadian markets in 2007 due to an increased risk of cardiac valve dysfunction. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8021 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21507864 PMID:8748627 DrugBank:DBSALT002445 PMID:19801850 PMID:11257938 PMID:20949429 PMID:15257688 PMID:10365192 PMID:7562267 CAS:66104-23-2 PMID:15602103 KEGG:D00502 PMID:6889702 PMID:12378837 PMID:27301465 PMID:24134630 PMID:23966481 Reaxys:5698117 PMID:21324306 PMID:19210262 PMID:14532675 Chemspider:43504 PMID:12446951 PMID:15591656 PMID:31082785 |
|
| definition |
A methanesulfonate salt obtained from pergolide by mixing eqimolar amount of pergolide and methanesulfonic acid. A dopamine D2 receptor agonist which also has D1 and D2 agonist properties, it is used in the management of Parkinson's disease, although it was withdrawn from the U.S. and Canadian markets in 2007 due to an increased risk of cardiac valve dysfunction. |
|
| formula |
C20H30N2O3S2 |
|
| has part | ||
| has_exact_synonym |
(8beta)-8-[(methylsulfanyl)methyl]-6-propylergoline methanesulfonate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pergolide methanesulfonate Pergolide mesilate (8beta)-8-[(methylsulfanyl)methyl]-6-propylergolin-6-ium methanesulfonate pergolide monomethanesulfonate pergolide monomesylate Permax |
|
| id |
CHEBI:8021 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H26N2S.CH4O3S/c1-3-7-21-11-13(12-22-2)8-16-15-5-4-6-17-19(15)14(10-20-17)9-18(16)21;1-5(2,3)4/h4-6,10,13,16,18,20H,3,7-9,11-12H2,1-2H3;1H3,(H,2,3,4)/t13-,16-,18-;/m1./s1 |
|
| inchikey |
UWCVGPLTGZWHGS-ZORIOUSZSA-N |
|
| label |
pergolide mesylate |
|
| mass |
410.59400 |
|
| monoisotopicmass |
410.16979 |
|
| notation |
CHEBI:8021 |
|
| prefLabel |
pergolide mesylate |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_51065 |
|
| smiles |
CS(O)(=O)=O.[H][C@@]12Cc3c[nH]c4cccc(c34)[C@@]1([H])C[C@@H](CSC)CN2CCC |
|
| subClassOf |