loading...| Preferred Name |
pemoline |
|
| Synonyms |
2-amino-5-phenyl-1,3-oxazol-4(5H)-one 2-imino-4-keto-5-phenyltetrahydrooxazole phenylpseudohydantoin phenylisohydantoin 2-imino-5-phenyl-4-oxazolidinone 5-phenyl-2-imino-4-oxooxazolidine pheniminooxazolidinone 5-phenyl-2-imino-4-oxazolidinone 2-Amino-5-phenyl-4(5H)-oxazolone 5-phenylisohydantion Azoxodon Betanamin Cylert Dantromin Deltamine Hyton Myamin Nitan Notair pemolina pemoline pemolinum |
|
| Definitions |
A member of the class of 1,3-oxazoles that is 1,3-oxazol-4(5H)-one which is substituted by an amino group at position 2 and by a phenyl group at position 5. A central nervous system stimulant, it was used to treat hyperactivity disorders in children, but withdrawn from use following reports of serious hepatotoxicity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7953 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2075 PMID:2210262 CAS:2152-34-3 PMID:2303976 Wikipedia:Pemoline Reaxys:151559 KEGG:C07899 DrugBank:DB01230 PMID:11216184 PMID:2388127 LINCS:LSM-5159 KEGG:D00744 PMID:641739 PMID:772696 PMID:4021028 |
|
| definition |
A member of the class of 1,3-oxazoles that is 1,3-oxazol-4(5H)-one which is substituted by an amino group at position 2 and by a phenyl group at position 5. A central nervous system stimulant, it was used to treat hyperactivity disorders in children, but withdrawn from use following reports of serious hepatotoxicity. |
|
| formula |
C9H8N2O2 |
|
| has_exact_synonym |
2-amino-5-phenyl-1,3-oxazol-4(5H)-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-imino-4-keto-5-phenyltetrahydrooxazole phenylpseudohydantoin phenylisohydantoin 2-imino-5-phenyl-4-oxazolidinone 5-phenyl-2-imino-4-oxooxazolidine pheniminooxazolidinone 5-phenyl-2-imino-4-oxazolidinone 2-Amino-5-phenyl-4(5H)-oxazolone 5-phenylisohydantion Azoxodon Betanamin Cylert Dantromin Deltamine Hyton Myamin Nitan Notair pemolina pemoline pemolinum |
|
| id |
CHEBI:7953 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H8N2O2/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6/h1-5,7H,(H2,10,11,12) |
|
| inchikey |
NRNCYVBFPDDJNE-UHFFFAOYSA-N |
|
| label |
pemoline |
|
| mass |
176.17200 |
|
| monoisotopicmass |
176.05858 |
|
| notation |
CHEBI:7953 |
|
| prefLabel |
pemoline |
|
| RO_0000087 | ||
| smiles |
NC1=NC(=O)C(O1)c1ccccc1 |
|
| subClassOf |