Preferred Name |
icariin |
|
Synonyms |
3-[(6-deoxy-alpha-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside ieariline |
|
Definitions |
A member of the class of flavonols that is kaempferol which is substituted at position 8 by a 3-methylbut-2-en-1-yl group and in which the hydroxy groups at positions 3, 4', and 7 have been converted to the corresponding 6-deoxy-alpha-L-mannopyranoside, methyl ether, and beta-D-glucopyranoside, respectively. A phoshphodiesterase-5 inhibitor, it is obtained from several species of plants in the genus Epimedium and is thought to be the main active ingredient of the Chinese herbal medicine Herba Epimedii (yinyanghuo). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_78420 |
|
charge |
0 |
|
database_cross_reference |
PMID:23824956 PMID:24462390 PMID:18053336 PMID:17355822 PMID:24552978 PMID:17169663 LIPID_MAPS_instance:LMPK12112009 PMID:24265111 PMID:24435883 PMID:24295650 Reaxys:76280 PMID:17499557 PMID:24748177 PMID:17764702 PMID:16380159 PMID:17482445 PMID:24590261 PMID:17419678 PMID:22216122 LINCS:LSM-3462 PMID:23975599 PMID:17613817 PMID:24311544 PMID:18398927 PMID:18778098 PMID:17142971 Wikipedia:Icariin PMID:17557750 PMID:16751992 PMID:24710854 PMID:18501540 PMID:17509675 PMID:24619236 KEGG:C17555 PMID:23772748 PMID:17120748 PMID:17600559 CAS:489-32-7 |
|
definition |
A member of the class of flavonols that is kaempferol which is substituted at position 8 by a 3-methylbut-2-en-1-yl group and in which the hydroxy groups at positions 3, 4', and 7 have been converted to the corresponding 6-deoxy-alpha-L-mannopyranoside, methyl ether, and beta-D-glucopyranoside, respectively. A phoshphodiesterase-5 inhibitor, it is obtained from several species of plants in the genus Epimedium and is thought to be the main active ingredient of the Chinese herbal medicine Herba Epimedii (yinyanghuo). |
|
formula |
C33H40O15 |
|
has_exact_synonym |
3-[(6-deoxy-alpha-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
ieariline |
|
id |
CHEBI:78420 |
|
in_subset | ||
inchi |
InChI=1S/C33H40O15/c1-13(2)5-10-17-19(45-33-28(42)26(40)23(37)20(12-34)46-33)11-18(35)21-24(38)31(48-32-27(41)25(39)22(36)14(3)44-32)29(47-30(17)21)15-6-8-16(43-4)9-7-15/h5-9,11,14,20,22-23,25-28,32-37,39-42H,10,12H2,1-4H3/t14-,20+,22-,23+,25+,26-,27+,28+,32-,33+/m0/s1 |
|
inchikey |
TZJALUIVHRYQQB-XLRXWWTNSA-N |
|
label |
icariin |
|
mass |
676.66170 |
|
monoisotopicmass |
676.23672 |
|
notation |
CHEBI:78420 |
|
prefLabel |
icariin |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50646 http://purl.obolibrary.org/obo/CHEBI_22586 |
|
smiles |
COc1ccc(cc1)-c1oc2c(CC=C(C)C)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c2c(=O)c1O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
|
subClassOf |
Delete | Mapping To | Ontology | Source |
---|---|---|---|
http://purl.obolibrary.org/obo/CHEBI_78420 | CHEBI | SAME_URI | |
http://purl.obolibrary.org/obo/CHEBI_78420 | CHEBI | LOOM | |
http://phenomebrowser.net/ontologies/mesh/mesh.owl#C056599 | RH-MESH | LOOM | |
http://purl.bioontology.org/ontology/MESH/C056599 | MESH | LOOM | |
http://purl.bioontology.org/ontology/RXNORM/1788871 | RXNORM | LOOM | |
https://go.drugbank.com/drugs/DB12052 | MDM | LOOM |