Preferred Name |
oxiconazole nitrate |
|
Synonyms |
(1Z)-N-[(2,4-dichlorobenzyl)oxy]-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanimine nitrate 2',4'-dichloro-2-imidazol-1-ylacetophenone (Z)-[OO-(2,4-dichlorobenzyl)oxime] mononitrate 1-[(2Z)-2-{[(2,4-dichlorobenzyl)oxy]imino}-2-(2,4-dichlorophenyl)ethyl]-1H-imidazol-3-ium nitrate Myfungar Oceral Oxistat Ro 13-8996 ST 813 ST-813 |
|
Definitions |
An organic nitrate salt resulting from the reaction of equimolar amounts of oxiconazole and nitric acid. An antifungal agent, it is used in creams and powders for the topical treatment of fungal skin infections. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7826 |
|
charge |
0 |
|
database_cross_reference |
HMDB:HMDB0014384 KEGG:D00885 DrugBank:DB00239 CAS:64211-46-7 KEGG:C08075 Reaxys:6042368 Patent:US4124767 Patent:DE2657578 |
|
definition |
An organic nitrate salt resulting from the reaction of equimolar amounts of oxiconazole and nitric acid. An antifungal agent, it is used in creams and powders for the topical treatment of fungal skin infections. |
|
formula |
C18H14Cl4N4O4 C18H13Cl4N3O.HNO3 |
|
has part | ||
has_exact_synonym |
(1Z)-N-[(2,4-dichlorobenzyl)oxy]-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanimine nitrate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2',4'-dichloro-2-imidazol-1-ylacetophenone (Z)-[OO-(2,4-dichlorobenzyl)oxime] mononitrate 1-[(2Z)-2-{[(2,4-dichlorobenzyl)oxy]imino}-2-(2,4-dichlorophenyl)ethyl]-1H-imidazol-3-ium nitrate Myfungar Oceral Oxistat Ro 13-8996 ST 813 ST-813 |
|
id |
CHEBI:7826 |
|
in_subset | ||
inchi |
InChI=1S/C18H13Cl4N3O.HNO3/c19-13-2-1-12(16(21)7-13)10-26-24-18(9-25-6-5-23-11-25)15-4-3-14(20)8-17(15)22;2-1(3)4/h1-8,11H,9-10H2;(H,2,3,4)/b24-18+; |
|
inchikey |
WVNOAGNOIPTWPT-NDUABGMUSA-N |
|
label |
oxiconazole nitrate |
|
mass |
492.14000 |
|
monoisotopicmass |
489.97692 |
|
notation |
CHEBI:7826 |
|
prefLabel |
oxiconazole nitrate |
|
smiles |
O[N+]([O-])=O.Clc1ccc(CO\N=C(/Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_87069 |