loading...| Preferred Name |
orphenadrine citrate |
|
| Synonyms |
N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine 2-hydroxypropane-1,2,3-tricarboxylate (+-)-N,N-dimethyl-2-((o-methyl-alpha-phenylbenzyl)oxy)ethylamine citrate orphenadrine dihydrogen citrate N,N-dimethyl-2-((o-methyl-alpha-phenylbenzyl)oxy)ethylamine citrate Banflex Flexon Norflex X-Otag |
|
| Definitions |
A citrate salt which comprises equimolar amounts of orphenadrine and citric acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7790 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00774 CAS:4682-36-4 Reaxys:4097848 DrugBank:DB01173 |
|
| definition |
A citrate salt which comprises equimolar amounts of orphenadrine and citric acid. |
|
| formula |
C24H31NO8 |
|
| has part | ||
| has_exact_synonym |
N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine 2-hydroxypropane-1,2,3-tricarboxylate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+-)-N,N-dimethyl-2-((o-methyl-alpha-phenylbenzyl)oxy)ethylamine citrate orphenadrine dihydrogen citrate N,N-dimethyl-2-((o-methyl-alpha-phenylbenzyl)oxy)ethylamine citrate Banflex Flexon Norflex X-Otag |
|
| id |
CHEBI:7790 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H23NO.C6H8O7/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-12,18H,13-14H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
|
| inchikey |
MMMNTDFSPSQXJP-UHFFFAOYSA-N |
|
| label |
orphenadrine citrate |
|
| mass |
461.50480 |
|
| monoisotopicmass |
461.20497 |
|
| notation |
CHEBI:7790 |
|
| prefLabel |
orphenadrine citrate |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_51371 http://purl.obolibrary.org/obo/CHEBI_48876 |
|
| smiles |
OC(=O)CC(O)(CC(O)=O)C(O)=O.CN(C)CCOC(c1ccccc1)c1ccccc1C |
|
| subClassOf |