loading...| Preferred Name | 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide | |
| Synonyms |
DL-Bupivacaine bupivacainum bupivacaina Marcaine 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
|
| Definitions |
A piperidinecarboxamide obtained by formal condensation of the carboxy group of N-butylpipecolic acid with the amino group of 2,6-dimethylaniline. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_77431 |
|
| alternative term |
DL-Bupivacaine bupivacainum bupivacaina Marcaine 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C07529 KEGG:D07552 CAS:38396-39-3 |
|
| definition |
A piperidinecarboxamide obtained by formal condensation of the carboxy group of N-butylpipecolic acid with the amino group of 2,6-dimethylaniline. |
|
| formula |
C18H28N2O |
|
| has_exact_synonym |
1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
DL-Bupivacaine bupivacainum bupivacaina Marcaine |
|
| id |
CHEBI:77431 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21) |
|
| inchikey |
LEBVLXFERQHONN-UHFFFAOYSA-N |
|
| is_conjugate_base_of | ||
| label |
1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
|
| mass |
288.42770 |
|
| monoisotopicmass |
288.22016 |
|
| notation |
CHEBI:77431 |
|
| prefLabel |
1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
|
| smiles |
CCCCN1CCCCC1C(=O)Nc1c(C)cccc1C |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_62733 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_77431 | DRON | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_77431 | PDRO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_77431 | DDSS | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_77431 | CHEBI | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_77431 | NIFSTD | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_77431 | DRON | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_77431 | PDRO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_77431 | DDSS | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_77431 | CHEBI | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_77431 | NIFSTD | LOOM |