Preferred Name |
dibenzoylmethane |
|
Synonyms |
1,3-diphenylpropane-1,3-dione 2-Benzoylacetophenone 1,3-Diphenyl-1,3-propanedione omega-Benzoylacetophenone Phenyl phenacyl ketone omega-benzoylacetophenone DBM |
|
Definitions |
A beta-diketone that is acetylacetone (acac) in which both methyl groups have been replaced by phenyl groups. It is a minor constituent of the root extract of licorice (Glycyrrhiza glabra) and exhibits antimutagenic and anticancer effects. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_75417 |
|
charge |
0 |
|
database_cross_reference |
CAS:120-46-7 PMID:21162108 PMID:12122651 PMID:19706764 Reaxys:514910 PMID:23586238 PMID:21341276 LINCS:LSM-2003 Wikipedia:Dibenzoylmethane PMID:21523861 |
|
definition |
A beta-diketone that is acetylacetone (acac) in which both methyl groups have been replaced by phenyl groups. It is a minor constituent of the root extract of licorice (Glycyrrhiza glabra) and exhibits antimutagenic and anticancer effects. |
|
formula |
C15H12O2 |
|
has_exact_synonym |
1,3-diphenylpropane-1,3-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Benzoylacetophenone 1,3-Diphenyl-1,3-propanedione omega-Benzoylacetophenone Phenyl phenacyl ketone omega-benzoylacetophenone DBM |
|
id |
CHEBI:75417 |
|
in_subset | ||
inchi |
InChI=1S/C15H12O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
|
inchikey |
NZZIMKJIVMHWJC-UHFFFAOYSA-N |
|
label |
dibenzoylmethane |
|
mass |
224.25460 |
|
monoisotopicmass |
224.08373 |
|
notation |
CHEBI:75417 |
|
prefLabel |
dibenzoylmethane |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
smiles |
O=C(CC(=O)c1ccccc1)c1ccccc1 |
|
subClassOf |