loading...| Preferred Name |
dibenzoylmethane |
|
| Synonyms |
1,3-diphenylpropane-1,3-dione 2-Benzoylacetophenone 1,3-Diphenyl-1,3-propanedione omega-Benzoylacetophenone Phenyl phenacyl ketone omega-benzoylacetophenone DBM |
|
| Definitions |
A beta-diketone that is acetylacetone (acac) in which both methyl groups have been replaced by phenyl groups. It is a minor constituent of the root extract of licorice (Glycyrrhiza glabra) and exhibits antimutagenic and anticancer effects. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_75417 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:120-46-7 PMID:21162108 PMID:12122651 PMID:19706764 Reaxys:514910 PMID:23586238 PMID:21341276 LINCS:LSM-2003 Wikipedia:Dibenzoylmethane PMID:21523861 |
|
| definition |
A beta-diketone that is acetylacetone (acac) in which both methyl groups have been replaced by phenyl groups. It is a minor constituent of the root extract of licorice (Glycyrrhiza glabra) and exhibits antimutagenic and anticancer effects. |
|
| formula |
C15H12O2 |
|
| has_exact_synonym |
1,3-diphenylpropane-1,3-dione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Benzoylacetophenone 1,3-Diphenyl-1,3-propanedione omega-Benzoylacetophenone Phenyl phenacyl ketone omega-benzoylacetophenone DBM |
|
| id |
CHEBI:75417 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H12O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
|
| inchikey |
NZZIMKJIVMHWJC-UHFFFAOYSA-N |
|
| label |
dibenzoylmethane |
|
| mass |
224.25460 |
|
| monoisotopicmass |
224.08373 |
|
| notation |
CHEBI:75417 |
|
| prefLabel |
dibenzoylmethane |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| smiles |
O=C(CC(=O)c1ccccc1)c1ccccc1 |
|
| subClassOf |