loading...| Preferred Name |
carglumic acid |
|
| Synonyms |
N-carbamoyl-L-glutamic acid acidum carglumicum carglumic acid acide carglumique Ureidoglutaric acid Carbamylglutamic acid (2S)-2-(carbamoylamino)pentanedioic acid L-N-Carbamoylglutamic acid Carbamino-L-glutamic acid acido carglumico Carbaglu |
|
| Definitions |
A urea that is the N-carbamoyl derivative of L-glutamic acid. An orphan drug used to treat a deficiency in the enzyme N-acetylglutamate synthase, which leads to acute hyperammonaemia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_71028 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:15055204 PMID:18234091 PMID:22858088 Drug_Central:3068 PMID:18516804 MetaCyc:N-CARBAMYL-L-GLUTAMATE DrugBank:DB06775 PMID:21225012 PMID:21207059 PMID:18604903 Reaxys:1727929 PMID:21941437 CAS:1188-38-1 HMDB:HMDB0015673 Wikipedia:Carglumic_acid PMID:20410539 PMID:17421020 KEGG:D07130 KEGG:C05829 PMID:21403788 |
|
| definition |
A urea that is the N-carbamoyl derivative of L-glutamic acid. An orphan drug used to treat a deficiency in the enzyme N-acetylglutamate synthase, which leads to acute hyperammonaemia. |
|
| formula |
C6H10N2O5 |
|
| has_exact_synonym |
N-carbamoyl-L-glutamic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
acidum carglumicum carglumic acid acide carglumique Ureidoglutaric acid Carbamylglutamic acid (2S)-2-(carbamoylamino)pentanedioic acid L-N-Carbamoylglutamic acid Carbamino-L-glutamic acid acido carglumico Carbaglu |
|
| id |
CHEBI:71028 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H10N2O5/c7-6(13)8-3(5(11)12)1-2-4(9)10/h3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13)/t3-/m0/s1 |
|
| inchikey |
LCQLHJZYVOQKHU-VKHMYHEASA-N |
|
| label |
carglumic acid |
|
| mass |
190.15400 |
|
| monoisotopicmass |
190.05897 |
|
| notation |
CHEBI:71028 |
|
| prefLabel |
carglumic acid |
|
| RO_0000087 | ||
| smiles |
NC(=O)N[C@@H](CCC(O)=O)C(O)=O |
|
| subClassOf |