loading...| Preferred Name |
vilazodone |
|
| Synonyms |
5-{4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl}-1-benzofuran-2-carboxamide vilazodonum vilazodona vilazodone |
|
| Definitions |
A 1-benzofuran that is 5-(piperazin-1-yl}-1-benzofuran-2-carboxamide having a (5-cyanoindol-3-yl)butyl group attached at position N-4 on the piperazine ring. Used for the treatment of major depressive disorder. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_70707 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22106941 PMID:21738107 PMID:22860155 KEGG:D09698 PMID:21527122 Patent:US5532241 PMID:19499624 PMID:23033234 Patent:WO2005018676 PMID:21951984 PMID:22970859 Wikipedia:Vilazodone PMID:22927207 PMID:22414078 Patent:WO2004113326 Drug_Central:4223 HMDB:HMDB0015637 PMID:22013560 CAS:163521-12-8 PMID:21323263 PMID:22339643 PMID:21869687 PMID:22284853 PMID:19764890 PMID:19284933 Patent:WO2005056056 PMID:22171584 PMID:22935937 DrugBank:DB06684 PMID:22536068 Patent:WO2005023243 Reaxys:9830698 PMID:21699273 PMID:21672888 Patent:US6531503 |
|
| definition |
A 1-benzofuran that is 5-(piperazin-1-yl}-1-benzofuran-2-carboxamide having a (5-cyanoindol-3-yl)butyl group attached at position N-4 on the piperazine ring. Used for the treatment of major depressive disorder. |
|
| formula |
C26H27N5O2 |
|
| has_exact_synonym |
5-{4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl}-1-benzofuran-2-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
vilazodonum vilazodona vilazodone |
|
| id |
CHEBI:70707 |
|
| in_subset | ||
| inchi |
InChI=1S/C26H27N5O2/c27-16-18-4-6-23-22(13-18)19(17-29-23)3-1-2-8-30-9-11-31(12-10-30)21-5-7-24-20(14-21)15-25(33-24)26(28)32/h4-7,13-15,17,29H,1-3,8-12H2,(H2,28,32) |
|
| inchikey |
SGEGOXDYSFKCPT-UHFFFAOYSA-N |
|
| is_conjugate_base_of | ||
| label |
vilazodone |
|
| mass |
441.52490 |
|
| monoisotopicmass |
441.21648 |
|
| notation |
CHEBI:70707 |
|
| prefLabel |
vilazodone |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50949 |
|
| smiles |
NC(=O)c1cc2cc(ccc2o1)N1CCN(CCCCc2c[nH]c3ccc(cc23)C#N)CC1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38830 http://purl.obolibrary.org/obo/CHEBI_46845 http://purl.obolibrary.org/obo/CHEBI_24828 http://purl.obolibrary.org/obo/CHEBI_46848 |