loading...| Preferred Name |
teriflunomide |
|
| Synonyms |
(2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide teriflunomidum teriflunomide teriflunomida (Z)-2-cyano-alpha,alpha,alpha-trifluoro-3-hydroxy-p-crotonotoluidide A 77-1726 A 771726 Aubagio HMR 1726 HMR1726 |
|
| Definitions |
An enamide obtained by formal condensation of the carboxy group of (2Z)-2-cyano-3-hydroxybut-2-enoic acid with the anilino group of 4-(trifluoromethyl)aniline. Used for the treatment of relapsing forms of multiple sclerosis and rheumatoid arthritis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_68540 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22052286 PMID:22426573 KEGG:D10172 PMID:21991951 Drug_Central:4634 PMID:22784880 PMID:21349677 PMID:21367665 PMID:21425264 PMID:20880295 PMID:22612746 PDBeChem:A26 PMID:22960763 PMID:22673950 PMID:22278631 CAS:163451-81-8 PMID:21625416 PMID:22012334 PMID:22622860 PMID:22766059 PMID:22398660 PMID:22965070 PMID:22307384 PMID:22796174 PMID:22052362 PMID:22723573 PMID:22148963 Reaxys:6655982 Wikipedia:Teriflunomide PMID:22229697 |
|
| definition |
An enamide obtained by formal condensation of the carboxy group of (2Z)-2-cyano-3-hydroxybut-2-enoic acid with the anilino group of 4-(trifluoromethyl)aniline. Used for the treatment of relapsing forms of multiple sclerosis and rheumatoid arthritis. |
|
| formula |
C12H9F3N2O2 |
|
| has_exact_synonym |
(2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
teriflunomidum teriflunomide teriflunomida (Z)-2-cyano-alpha,alpha,alpha-trifluoro-3-hydroxy-p-crotonotoluidide A 77-1726 A 771726 Aubagio HMR 1726 HMR1726 |
|
| id |
CHEBI:68540 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H9F3N2O2/c1-7(18)10(6-16)11(19)17-9-4-2-8(3-5-9)12(13,14)15/h2-5,18H,1H3,(H,17,19)/b10-7- |
|
| inchikey |
UTNUDOFZCWSZMS-YFHOEESVSA-N |
|
| label |
teriflunomide |
|
| mass |
270.20730 |
|
| monoisotopicmass |
270.06161 |
|
| notation |
CHEBI:68540 |
|
| prefLabel |
teriflunomide |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_38637 http://purl.obolibrary.org/obo/CHEBI_49103 http://purl.obolibrary.org/obo/CHEBI_68542 |
|
| smiles |
C\C(O)=C(/C#N)C(=O)Nc1ccc(cc1)C(F)(F)F |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_51751 http://purl.obolibrary.org/obo/CHEBI_140325 http://purl.obolibrary.org/obo/CHEBI_62733 http://purl.obolibrary.org/obo/CHEBI_33823 |