loading...| Preferred Name |
methoxamine |
|
| Synonyms |
Methoxamine methoxamedrine methoxamin |
|
| Definitions |
An amphetamine in which the parent 1-phenylpropan-2-amine skeleton is substituted at position 1 with an hydroxy group and the phenyl ring is 2- and 5-substituted with methoxy groups. It is an antihypotensive agent (pressor), an agonist acting directly at alpha-adrenoceptors with selectivity for the alpha-1 adrenoceptor subtype similar to phenylephrine . |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6839 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C07513 PMID:24282936 KEGG:D08201 PMID:28599629 CAS:390-28-3 PMID:28166217 PMID:26914134 LINCS:LSM-4423 |
|
| definition |
An amphetamine in which the parent 1-phenylpropan-2-amine skeleton is substituted at position 1 with an hydroxy group and the phenyl ring is 2- and 5-substituted with methoxy groups. It is an antihypotensive agent (pressor), an agonist acting directly at alpha-adrenoceptors with selectivity for the alpha-1 adrenoceptor subtype similar to phenylephrine . |
|
| formula |
C11H17NO3 |
|
| has_exact_synonym |
Methoxamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
methoxamedrine methoxamin |
|
| id |
CHEBI:6839 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H17NO3/c1-7(12)11(13)9-6-8(14-2)4-5-10(9)15-3/h4-7,11,13H,12H2,1-3H3 |
|
| inchikey |
WJAJPNHVVFWKKL-UHFFFAOYSA-N |
|
| label |
methoxamine |
|
| mass |
211.258 |
|
| monoisotopicmass |
211.12084 |
|
| notation |
CHEBI:6839 |
|
| prefLabel |
methoxamine |
|
| RO_0000087 | ||
| smiles |
C1=C(C=CC(=C1C(O)C(C)N)OC)OC |
|
| subClassOf |