Preferred Name |
lysergic acid diethylamide |
|
Synonyms |
Lysergic acid diethylamide (8R)-9,10-didehydro-N,N-diethyl-6-methylergoline-8-carboxamide N,N-diethyl-(+)-lysergamide Lysergsaeurediaethylamid N,N-diethyl-D-lysergamide N,N-diethyllysergamide D-lysergic acid diethylamide Lysergsaeurediethylamid (+)-LSD LSD LSD 25 Lysergide |
|
Definitions |
An ergoline alkaloid arising from formal condensation of lysergic acid with diethylamine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6605 |
|
charge |
0 |
|
database_cross_reference |
Patent:US3141887 Reaxys:94179 PMID:23423312 PMID:24594678 MetaCyc:CPD-14458 PMID:9698051 KEGG:C07542 PMID:24830180 PMID:16005500 PMID:11723224 Patent:US2774763 Drug_Central:1621 PMID:22898355 PMID:17077317 Patent:US2736728 CAS:50-37-3 PMID:8428600 PMID:13952224 PMID:25036425 PMID:24785760 PMID:23222128 Wikipedia:Lysergic_acid_diethylamide Beilstein:94179 |
|
definition |
An ergoline alkaloid arising from formal condensation of lysergic acid with diethylamine. |
|
formula |
C20H25N3O |
|
has_exact_synonym |
Lysergic acid diethylamide (8R)-9,10-didehydro-N,N-diethyl-6-methylergoline-8-carboxamide |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N,N-diethyl-(+)-lysergamide Lysergsaeurediaethylamid N,N-diethyl-D-lysergamide N,N-diethyllysergamide D-lysergic acid diethylamide Lysergsaeurediethylamid (+)-LSD LSD LSD 25 Lysergide |
|
id |
CHEBI:6605 |
|
in_subset | ||
inchi |
InChI=1S/C20H25N3O/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3/t14-,18-/m1/s1 |
|
inchikey |
VAYOSLLFUXYJDT-RDTXWAMCSA-N |
|
label |
lysergic acid diethylamide |
|
mass |
323.43200 |
|
monoisotopicmass |
323.19976 |
|
notation |
CHEBI:6605 |
|
prefLabel |
lysergic acid diethylamide |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35499 |
|
smiles |
[H][C@@]12Cc3c[nH]c4cccc(C1=C[C@H](CN2C)C(=O)N(CC)CC)c34 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_60529 |