loading...| Preferred Name |
lorcaserin hydrochloride |
|
| Synonyms |
(1R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepinium chloride (1R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride |
|
| Definitions |
A hydrochloride obtained by reaction of lorcaserin with one equivalent of hydrochloric acid. Used as an anti-obesity drug. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_65350 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21795446 PMID:20647200 PMID:22189292 PMID:22435392 PMID:21158669 PMID:19900026 PMID:22011982 PMID:21082598 PMID:21438803 PMID:21102648 PMID:22259019 PMID:22778808 PMID:21589947 PMID:21190985 PMID:22266842 PMID:21267355 CAS:846589-98-8 PMID:22249823 PMID:21158670 PMID:21158671 PMID:21181547 PMID:22421927 KEGG:D06613 PMID:21412231 Reaxys:11805340 |
|
| definition |
A hydrochloride obtained by reaction of lorcaserin with one equivalent of hydrochloric acid. Used as an anti-obesity drug. |
|
| formula |
C11H15Cl2N |
|
| has part | ||
| has_exact_synonym |
(1R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepinium chloride (1R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:65350 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H14ClN.ClH/c1-8-7-13-5-4-9-2-3-10(12)6-11(8)9;/h2-3,6,8,13H,4-5,7H2,1H3;1H/t8-;/m0./s1 |
|
| inchikey |
ITIHHRMYZPNGRC-QRPNPIFTSA-N |
|
| label |
lorcaserin hydrochloride |
|
| mass |
232.15000 |
|
| monoisotopicmass |
231.05815 |
|
| notation |
CHEBI:65350 |
|
| prefLabel |
lorcaserin hydrochloride |
|
| RO_0000087 | ||
| smiles |
Cl.C[C@H]1CNCCc2ccc(Cl)cc12 |
|
| subClassOf |