loading...| Preferred Name | liothyronine sodium | |
| Synonyms |
3,3',5-Triiodothyronine sodium salt 3,3',5-Triiodo-L-thyronine sodium Monosodium L-3-(4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl)alanine Cytomel Triostat sodium (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoate |
|
| Definitions |
The sodium salt of liothyronine. Thought to be more active than levothyroxine and with a rapid (few hours) onset and short duration of action, liothyronine sodium is used in the treatment of hypothyroidism, particularly in cases of hypothyroid coma. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6484 |
|
| alternative term |
3,3',5-Triiodothyronine sodium salt 3,3',5-Triiodo-L-thyronine sodium Monosodium L-3-(4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl)alanine Cytomel Triostat sodium (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoate |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Liothyronine_Sodium KEGG:D01011 CAS:55-06-1 Patent:US2002193440 PMID:17634708 Reaxys:8179867 Beilstein:8179867 PMID:29216618 PMID:28599168 |
|
| definition |
The sodium salt of liothyronine. Thought to be more active than levothyroxine and with a rapid (few hours) onset and short duration of action, liothyronine sodium is used in the treatment of hypothyroidism, particularly in cases of hypothyroid coma. |
|
| formula |
C15H11I3NO4.Na C15H11I3NNaO4 |
|
| has part | ||
| has_exact_synonym |
sodium (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3,3',5-Triiodothyronine sodium salt 3,3',5-Triiodo-L-thyronine sodium Monosodium L-3-(4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl)alanine Cytomel Triostat |
|
| id |
CHEBI:6484 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H12I3NO4.Na/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22;/h1-4,6,12,20H,5,19H2,(H,21,22);/q;+1/p-1/t12-;/m0./s1 |
|
| inchikey |
SBXXSUDPJJJJLC-YDALLXLXSA-M |
|
| label |
liothyronine sodium |
|
| mass |
672.95530 |
|
| monoisotopicmass |
672.77199 |
|
| notation |
CHEBI:6484 |
|
| overlaps | ||
| prefLabel |
liothyronine sodium |
|
| smiles |
[Na+].N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C([O-])=O |
|
| subClassOf |