Preferred Name |
diethylpropion hydrochloride |
|
Synonyms |
Diethylpropion hydrochloride N,N-diethyl-1-oxo-1-phenylpropan-2-aminium chloride DIETHYLPROPION HYDROCHLORIDE amfepramone HCl 2-(diethylamino)-1-phenylpropan-1-one hydrochloride alpha-benzoyltriethylamine hydrochloride alpha-benzoyltriethylammonium chloride 2-(diethylamino)propiophenone hydrochloride amphepramonum hydrochloride diethylpropion HCl amfepramone hydrochloride tenuate |
|
Definitions |
The hydrochloride salt of diethylpropion. A central stimulant and indirect-acting sympathomimetic, it is an appetite depressant and is used as an anoretic in the short term management of obesity. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_643703 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D03801 CAS:134-80-5 DrugBank:DB00937 Beilstein:3915870 |
|
definition |
The hydrochloride salt of diethylpropion. A central stimulant and indirect-acting sympathomimetic, it is an appetite depressant and is used as an anoretic in the short term management of obesity. |
|
formula |
C13H20ClNO |
|
has part | ||
has_alternative_id |
CHEBI:130909 |
|
has_exact_synonym |
Diethylpropion hydrochloride N,N-diethyl-1-oxo-1-phenylpropan-2-aminium chloride DIETHYLPROPION HYDROCHLORIDE |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
amfepramone HCl 2-(diethylamino)-1-phenylpropan-1-one hydrochloride alpha-benzoyltriethylamine hydrochloride alpha-benzoyltriethylammonium chloride 2-(diethylamino)propiophenone hydrochloride amphepramonum hydrochloride diethylpropion HCl amfepramone hydrochloride tenuate |
|
id |
CHEBI:643703 |
|
in_subset | ||
inchi |
InChI=1S/C13H19NO.ClH/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12;/h6-11H,4-5H2,1-3H3;1H |
|
inchikey |
ICFXZZFWRWNZMA-UHFFFAOYSA-N |
|
label |
diethylpropion hydrochloride |
|
mass |
241.75700 |
|
monoisotopicmass |
241.12334 |
|
notation |
CHEBI:643703 |
|
prefLabel |
diethylpropion hydrochloride |
|
RO_0000087 | ||
smiles |
[Cl-].CC[NH+](CC)C(C)C(=O)c1ccccc1 |
|
subClassOf |