Preferred Name |
ketorolac tromethamine |
|
Synonyms |
1,3-dihydroxy-2-(hydroxymethyl)propan-2-aminium 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate Acular Acuvail Dolac Lixidol Sprix Toradol |
|
Definitions |
An organoammonium salt resulting from the mixture of equimolar amounts of ketorolac and tromethamine (tris). It has potent non-sedating analgesic and moderate anti-inflammatory effects. It is used in the short-term management of post-operative pain, and in eye drops to relieve the ocular itching associated with seasonal allergic conjunctivitis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6130 |
|
charge |
0 |
|
database_cross_reference |
PMID:23098098 PMID:23016110 PMID:8863973 Reaxys:6463165 PMID:19663721 HMDB:HMDB0014608 DrugBank:DB00465 PMID:23302965 CAS:74103-07-4 PMID:23199134 PMID:23992042 KEGG:D00813 |
|
definition |
An organoammonium salt resulting from the mixture of equimolar amounts of ketorolac and tromethamine (tris). It has potent non-sedating analgesic and moderate anti-inflammatory effects. It is used in the short-term management of post-operative pain, and in eye drops to relieve the ocular itching associated with seasonal allergic conjunctivitis. |
|
formula |
C19H24N2O6 |
|
has part | ||
has_exact_synonym |
1,3-dihydroxy-2-(hydroxymethyl)propan-2-aminium 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Acular Acuvail Dolac Lixidol Sprix Toradol |
|
id |
CHEBI:6130 |
|
in_subset | ||
inchi |
InChI=1S/C15H13NO3.C4H11NO3/c17-14(10-4-2-1-3-5-10)13-7-6-12-11(15(18)19)8-9-16(12)13;5-4(1-6,2-7)3-8/h1-7,11H,8-9H2,(H,18,19);6-8H,1-3,5H2 |
|
inchikey |
BWHLPLXXIDYSNW-UHFFFAOYSA-N |
|
label |
ketorolac tromethamine |
|
mass |
376.40370 |
|
monoisotopicmass |
376.16344 |
|
notation |
CHEBI:6130 |
|
prefLabel |
ketorolac tromethamine |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50629 |
|
smiles |
[NH3+]C(CO)(CO)CO.[O-]C(=O)C1CCn2c1ccc2C(=O)c1ccccc1 |
|
subClassOf |