loading...| Preferred Name |
erythrityl tetranitrate |
|
| Synonyms |
1,2,3,4-butanetetralyl tetranitrate tetranitrin tetranitrate d'eritrityle meso-erythritol tetranitrate (2R*,3S)-rel-1,2,3,4-butanetetroltetranitrate tetranitrol eritrityl tetranitrate erythritol tetranitrate erythrol tetranitrate tetranitrato de eritritilo eritrityli tetranitras ETN (2R*,3S*)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate |
|
| Definitions |
Erythritol in which each of the hydroxy groups has been converted to the corresponding nitrate ester. It is a vasodilator with properties similar to nitroglycerin. It is usually used diluted with lactose or other suitable inert excipients, in order to minimise the risk of explosion; undiluted erythrityl tetranitrate can be exploded by percussion or excessive heat. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_60072 |
|
| alternative term |
1,2,3,4-butanetetralyl tetranitrate tetranitrin tetranitrate d'eritrityle meso-erythritol tetranitrate (2R*,3S)-rel-1,2,3,4-butanetetroltetranitrate tetranitrol eritrityl tetranitrate erythritol tetranitrate erythrol tetranitrate tetranitrato de eritritilo eritrityli tetranitras ETN (2R*,3S*)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
Beilstein:1730082 KEGG:D04051 Drug_Central:1047 Wikipedia:Erythritol_tetranitrate DrugBank:DB01613 CAS:7297-25-8 |
|
| definition |
Erythritol in which each of the hydroxy groups has been converted to the corresponding nitrate ester. It is a vasodilator with properties similar to nitroglycerin. It is usually used diluted with lactose or other suitable inert excipients, in order to minimise the risk of explosion; undiluted erythrityl tetranitrate can be exploded by percussion or excessive heat. |
|
| formula |
C4H6N4O12 |
|
| has_exact_synonym |
(2R*,3S*)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1,2,3,4-butanetetralyl tetranitrate tetranitrin tetranitrate d'eritrityle meso-erythritol tetranitrate (2R*,3S)-rel-1,2,3,4-butanetetroltetranitrate tetranitrol eritrityl tetranitrate erythritol tetranitrate erythrol tetranitrate tetranitrato de eritritilo eritrityli tetranitras ETN |
|
| id |
CHEBI:60072 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H6N4O12/c9-5(10)17-1-3(19-7(13)14)4(20-8(15)16)2-18-6(11)12/h3-4H,1-2H2/t3-,4+ |
|
| inchikey |
SNFOERUNNSHUGP-ZXZARUISSA-N |
|
| label |
erythrityl tetranitrate |
|
| mass |
302.11000 |
|
| monoisotopicmass |
301.99822 |
|
| notation |
CHEBI:60072 |
|
| prefLabel |
erythrityl tetranitrate |
|
| RO_0000087 | ||
| smiles |
[O-][N+](=O)OC[C@@H](O[N+]([O-])=O)[C@H](CO[N+]([O-])=O)O[N+]([O-])=O |
|
| subClassOf |