Preferred Name |
encainide hydrochloride |
|
Synonyms |
2-(2-{2-[(4-methoxybenzoyl)amino]phenyl}ethyl)-1-methylpiperidinium chloride encainide HCl 4-methoxy-2'-(2-(1-methyl-2-piperidyl)ethyl)benzanilide hydrochloride (+-)-2'-(2-(1-methyl-2-piperidyl)ethyl)-p-anisanilide monohydrochloride 4-methoxy-N-{2-[2-(1-methylpiperidin-2-yl)ethyl]phenyl}benzamide hydrochloride |
|
Definitions |
The hydrochloride salt of encainide. A class Ic antiarrhythmic, it was used for the treatment of severe or life-threatening ventricular arrhythmias, but it was associated with increased death rates in patients who had asymptomatic heart rhythm abnormalities after a recent heart attack and was withdrawn from the market. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_59880 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D03991 Beilstein:6360008 DrugBank:DB01228 CAS:66794-74-9 |
|
definition |
The hydrochloride salt of encainide. A class Ic antiarrhythmic, it was used for the treatment of severe or life-threatening ventricular arrhythmias, but it was associated with increased death rates in patients who had asymptomatic heart rhythm abnormalities after a recent heart attack and was withdrawn from the market. |
|
formula |
C22H29ClN2O2 |
|
has part | ||
has_exact_synonym |
2-(2-{2-[(4-methoxybenzoyl)amino]phenyl}ethyl)-1-methylpiperidinium chloride |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
encainide HCl 4-methoxy-2'-(2-(1-methyl-2-piperidyl)ethyl)benzanilide hydrochloride (+-)-2'-(2-(1-methyl-2-piperidyl)ethyl)-p-anisanilide monohydrochloride 4-methoxy-N-{2-[2-(1-methylpiperidin-2-yl)ethyl]phenyl}benzamide hydrochloride |
|
id |
CHEBI:59880 |
|
in_subset | ||
inchi |
InChI=1S/C22H28N2O2.ClH/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18;/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25);1H |
|
inchikey |
OJIIZIWOLTYOBS-UHFFFAOYSA-N |
|
label |
encainide hydrochloride |
|
mass |
388.93100 |
|
monoisotopicmass |
388.19176 |
|
notation |
CHEBI:59880 |
|
prefLabel |
encainide hydrochloride |
|
RO_0000087 | ||
smiles |
Cl.COc1ccc(cc1)C(=O)Nc1ccccc1CCC1CCCCN1C |
|
subClassOf |