loading...| Preferred Name |
difenoxin hydrochloride |
|
| Synonyms |
4-carboxy-1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidinium chloride difenoxin HCl diphenoxylic acid hydrochloride 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylic acid hydrochloride 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotic acid hydrochloride |
|
| Definitions |
The hydrochloride salt of difenoxin. It has similar actions and uses to diphenoxylate hydrochloride, being administered for the symptomatic treatment of acute and chronic diarrhoea. In an attempt to discourage abuse (at high doses, difenoxin acts like morphine), preparations usually contain subclinical amounts of atropine sulfate. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_59790 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:35607-36-4 |
|
| definition |
The hydrochloride salt of difenoxin. It has similar actions and uses to diphenoxylate hydrochloride, being administered for the symptomatic treatment of acute and chronic diarrhoea. In an attempt to discourage abuse (at high doses, difenoxin acts like morphine), preparations usually contain subclinical amounts of atropine sulfate. |
|
| formula |
C28H29ClN2O2 |
|
| has part | ||
| has_exact_synonym |
4-carboxy-1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidinium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
difenoxin HCl diphenoxylic acid hydrochloride 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylic acid hydrochloride 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotic acid hydrochloride |
|
| id |
CHEBI:59790 |
|
| in_subset | ||
| inchi |
InChI=1S/C28H28N2O2.ClH/c29-22-28(24-12-6-2-7-13-24,25-14-8-3-9-15-25)18-21-30-19-16-27(17-20-30,26(31)32)23-10-4-1-5-11-23;/h1-15H,16-21H2,(H,31,32);1H |
|
| inchikey |
VMIZTXDGZPTKIK-UHFFFAOYSA-N |
|
| label |
difenoxin hydrochloride |
|
| mass |
460.99500 |
|
| monoisotopicmass |
460.19176 |
|
| notation |
CHEBI:59790 |
|
| prefLabel |
difenoxin hydrochloride |
|
| RO_0000087 | ||
| smiles |
[Cl-].OC(=O)C1(CC[NH+](CC1)CCC(C#N)(c1ccccc1)c1ccccc1)c1ccccc1 |
|
| subClassOf |